C19H24N4O — CID 165366822
(1R,2S,10S,13S)-17-methoxy-10-methyl-6,7,8,9-tetrazapentacyclo[11.8.0.02,10.05,9.014,19]henicosa-5,7,14(19),15,17-pentaene (PubChem CID 165366822) has the molecular formula C19H24N4O and a molecular weight of 324.43 g/mol. Its IUPAC name is (1R,2S,10S,13S)-17-methoxy-10-methyl-6,7,8,9-tetrazapentacyclo[11.8.0.02,10.05,9.014,19]henicosa-5,7,14(19),15,17-pentaene.
| Compound Name | (1R,2S,10S,13S)-17-methoxy-10-methyl-6,7,8,9-tetrazapentacyclo[11.8.0.02,10.05,9.014,19]henicosa-5,7,14(19),15,17-pentaene |
|---|---|
| PubChem CID | 165366822 |
| Molecular Formula | C19H24N4O |
| Molecular Weight | 324.43 g/mol |
| Exact Mass | 324.20 |
| IUPAC Name | (1R,2S,10S,13S)-17-methoxy-10-methyl-6,7,8,9-tetrazapentacyclo[11.8.0.02,10.05,9.014,19]henicosa-5,7,14(19),15,17-pentaene |
| SMILES | COc1ccc2c(c1)CC[C@@H]1[C@@H]2CC[C@@]2(C)[C@H]1CCc1nnnn12 |
| InChI | InChI=1S/C19H24N4O/c1-19-10-9-15-14-6-4-13(24-2)11-12(14)3-5-16(15)17(19)7-8-18-20-21-22-23(18)19/h4,6,11,15-17H,3,5,7-10H2,1-2H3/t15-,16-,17+,19+/m1/s1 |
| InChIKey | BJBAWXSLGNUNNL-VXNCWWDNSA-N |
| XLogP | 3.10 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.43 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |