C14H18O6 — CID 165368364
4-[(E)-hydroxy-[(6R)-6-methyl-2,4-dioxooxan-3-ylidene]methyl]cyclohexane-1-carboxylic acid (PubChem CID 165368364) has the molecular formula C14H18O6 and a molecular weight of 282.29 g/mol. Its IUPAC name is 4-[(E)-hydroxy-[(6R)-6-methyl-2,4-dioxooxan-3-ylidene]methyl]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[(E)-hydroxy-[(6R)-6-methyl-2,4-dioxooxan-3-ylidene]methyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 165368364 |
| Molecular Formula | C14H18O6 |
| Molecular Weight | 282.29 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | 4-[(E)-hydroxy-[(6R)-6-methyl-2,4-dioxooxan-3-ylidene]methyl]cyclohexane-1-carboxylic acid |
| SMILES | C[C@@H]1CC(=O)/C(=C(\O)C2CCC(C(=O)O)CC2)C(=O)O1 |
| InChI | InChI=1S/C14H18O6/c1-7-6-10(15)11(14(19)20-7)12(16)8-2-4-9(5-3-8)13(17)18/h7-9,16H,2-6H2,1H3,(H,17,18)/b12-11+/t7-,8?,9?/m1/s1 |
| InChIKey | NHDHBOGGTDKGAI-XFYGOMLKSA-N |
| XLogP | 1.59 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.29 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|