C15H22O5 — CID 165368391
(3E,6R)-3-[1-hydroxy-4-(oxan-4-yl)butylidene]-6-methyloxane-2,4-dione (PubChem CID 165368391) has the molecular formula C15H22O5 and a molecular weight of 282.34 g/mol. Its IUPAC name is (3E,6R)-3-[1-hydroxy-4-(oxan-4-yl)butylidene]-6-methyloxane-2,4-dione.
| Compound Name | (3E,6R)-3-[1-hydroxy-4-(oxan-4-yl)butylidene]-6-methyloxane-2,4-dione |
|---|---|
| PubChem CID | 165368391 |
| Molecular Formula | C15H22O5 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | (3E,6R)-3-[1-hydroxy-4-(oxan-4-yl)butylidene]-6-methyloxane-2,4-dione |
| SMILES | C[C@@H]1CC(=O)/C(=C(\O)CCCC2CCOCC2)C(=O)O1 |
| InChI | InChI=1S/C15H22O5/c1-10-9-13(17)14(15(18)20-10)12(16)4-2-3-11-5-7-19-8-6-11/h10-11,16H,2-9H2,1H3/b14-12+/t10-/m1/s1 |
| InChIKey | OSMOFTCISLDDQZ-NOHQBZTLSA-N |
| XLogP | 2.30 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|