C29H37NO4 — CID 165372483
tert-butyl (5Z)-5-[1-[(4-methoxyphenyl)methyl]-5,5-dimethyl-2-oxopyrrolidin-3-ylidene]-5-phenylpentanoate (PubChem CID 165372483) has the molecular formula C29H37NO4 and a molecular weight of 463.62 g/mol. Its IUPAC name is tert-butyl (5Z)-5-[1-[(4-methoxyphenyl)methyl]-5,5-dimethyl-2-oxopyrrolidin-3-ylidene]-5-phenylpentanoate.
| Compound Name | tert-butyl (5Z)-5-[1-[(4-methoxyphenyl)methyl]-5,5-dimethyl-2-oxopyrrolidin-3-ylidene]-5-phenylpentanoate |
|---|---|
| PubChem CID | 165372483 |
| Molecular Formula | C29H37NO4 |
| Molecular Weight | 463.62 g/mol |
| Exact Mass | 463.27 |
| IUPAC Name | tert-butyl (5Z)-5-[1-[(4-methoxyphenyl)methyl]-5,5-dimethyl-2-oxopyrrolidin-3-ylidene]-5-phenylpentanoate |
| SMILES | COc1ccc(CN2C(=O)/C(=C(/CCCC(=O)OC(C)(C)C)c3ccccc3)CC2(C)C)cc1 |
| InChI | InChI=1S/C29H37NO4/c1-28(2,3)34-26(31)14-10-13-24(22-11-8-7-9-12-22)25-19-29(4,5)30(27(25)32)20-21-15-17-23(33-6)18-16-21/h7-9,11-12,15-18H,10,13-14,19-20H2,1-6H3/b25-24- |
| InChIKey | QHDUNCGOTQPWQK-IZHYLOQSSA-N |
| XLogP | 6.17 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.62 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|