About CID 165374860
CID 165374860 (PubChem CID 165374860) has the molecular formula C66H62N4OPt-2
and a molecular weight of 1122.33 g/mol.
Molecular Properties
| Compound Name | CID 165374860 |
| PubChem CID | 165374860 |
| Molecular Formula | C66H62N4OPt-2 |
| Molecular Weight | 1122.33 g/mol |
| Exact Mass | 1121.46 |
| IUPAC Name | — |
| SMILES | Cc1ccc(-[n+]2[c-]n3c4c(cccc42)C2(c4ccc(Oc5[c-]c6c(cc5)c5ccccc5n6-c5ccccn5)[c-]c4-3)c3c(cc(C(C)(C)C)cc3C(C)(C)C)-c3cc(C(C)(C)C)cc(C(C)(C)C)c32)cc1.[Pt] |
| InChI | InChI=1S/C66H62N4O.Pt/c1-40-24-26-43(27-25-40)68-39-69-57-38-45(71-44-28-30-47-46-19-14-15-21-54(46)70(56(47)37-44)58-23-16-17-32-67-58)29-31-50(57)66(51-20-18-22-55(68)61(51)69)59-48(33-41(62(2,3)4)35-52(59)64(8,9)10)49-34-42(63(5,6)7)36-53(60(49)66)65(11,12)13;/h14-36H,1-13H3;/q-2; |
| InChIKey | RNYOYDKCLYCPKY-UHFFFAOYSA-N |
| XLogP | 15.76 |
| TPSA | 35.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 72 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 1122.33 |
| LogP ≤ 5 | 15.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze CID 165374860 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 165374860?
The IUPAC name of CID 165374860 (CID 165374860) is not available.
What is the SMILES notation for CID 165374860?
The canonical SMILES for CID 165374860 is Cc1ccc(-[n+]2[c-]n3c4c(cccc42)C2(c4ccc(Oc5[c-]c6c(cc5)c5ccccc5n6-c5ccccn5)[c-]c4-3)c3c(cc(C(C)(C)C)cc3C(C)(C)C)-c3cc(C(C)(C)C)cc(C(C)(C)C)c32)cc1.[Pt].
What is the InChIKey of CID 165374860?
The InChIKey is RNYOYDKCLYCPKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C66H62N4O.Pt/c1-40-24-26-43(27-25-40)68-39-69-57-38-45(71-44-28-30-47-46-19-14-15-21-54(46)70(56(47)37-44)58-23-16-17-32-67-58)29-31-50(57)66(51-20-18-22-55(68)61(51)69)59-48(33-41(62(2,3)4)35-52(59)64(8,9)10)49-34-42(63(5,6)7)36-53(60(49)66)65(11,12)13;/h14-36H,1-13H3;/q-2;.
What are the key properties of CID 165374860?
CID 165374860 has a molecular weight of 1122.33 g/mol, XLogP of 15.76, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 165374860 is sourced from PubChem (CID 165374860), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).