C43H34N4OPt-2 — CID 155616496
CID 155616496 (PubChem CID 155616496) has the molecular formula C43H34N4OPt-2 and a molecular weight of 817.85 g/mol.
| Compound Name | CID 155616496 |
|---|---|
| PubChem CID | 155616496 |
| Molecular Formula | C43H34N4OPt-2 |
| Molecular Weight | 817.85 g/mol |
| Exact Mass | 817.24 |
| IUPAC Name | — |
| SMILES | CC(C)(C)c1ccnc(-n2c3[c-]c(Oc4[c-]c5c(cc4)C(C)(C)c4cccc6c4n-5[c-][n+]6-c4ccccc4)ccc3c3ccccc32)c1.[Pt] |
| InChI | InChI=1S/C43H34N4O.Pt/c1-42(2,3)28-22-23-44-40(24-28)47-36-16-10-9-14-32(36)33-20-18-30(25-38(33)47)48-31-19-21-34-39(26-31)46-27-45(29-12-7-6-8-13-29)37-17-11-15-35(41(37)46)43(34,4)5;/h6-24H,1-5H3;/q-2; |
| InChIKey | HMEAZOUAGXIINO-UHFFFAOYSA-N |
| XLogP | 9.53 |
| TPSA | 35.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 817.85 |
| LogP ≤ 5 | 9.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|