C52H50N4OPt-2 — CID 164734283
CID 164734283 (PubChem CID 164734283) has the molecular formula C52H50N4OPt-2 and a molecular weight of 942.08 g/mol.
| Compound Name | CID 164734283 |
|---|---|
| PubChem CID | 164734283 |
| Molecular Formula | C52H50N4OPt-2 |
| Molecular Weight | 942.08 g/mol |
| Exact Mass | 941.36 |
| IUPAC Name | — |
| SMILES | CC(C)(C)c1ccnc(-n2c3[c-]c(Oc4[c-]c5c(cc4)C(C)(C)C(C)(C)c4ccc6c7c4n-5c(=[Pt])n7-c4ccccc4C(C)(C)C6(C)C)ccc3c3ccccc32)c1 |
| InChI | InChI=1S/C52H50N4O.Pt/c1-48(2,3)32-26-27-53-45(28-32)56-41-18-14-12-16-35(41)36-22-20-33(29-43(36)56)57-34-21-23-38-44(30-34)55-31-54-42-19-15-13-17-37(42)49(4,5)51(8,9)39-24-25-40(47(55)46(39)54)52(10,11)50(38,6)7;/h12-28H,1-11H3;/q-2; |
| InChIKey | IWDKCUFLKWJURX-UHFFFAOYSA-N |
| XLogP | 12.82 |
| TPSA | 36.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 942.08 |
| LogP ≤ 5 | 12.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|