C52H36N4OPtSi-2 — CID 167345577
CID 167345577 (PubChem CID 167345577) has the molecular formula C52H36N4OPtSi-2 and a molecular weight of 956.05 g/mol.
| Compound Name | CID 167345577 |
|---|---|
| PubChem CID | 167345577 |
| Molecular Formula | C52H36N4OPtSi-2 |
| Molecular Weight | 956.05 g/mol |
| Exact Mass | 955.23 |
| IUPAC Name | — |
| SMILES | CC(C)(C)c1ccnc(-n2c3[c-]c(Oc4[c-]c5c(cc4)[Si]c4cccc6c4n-5[c-][n+]6-c4ccccc4)ccc3c3c(-c4ccccc4)cc(-c4ccccc4)cc32)c1.[Pt] |
| InChI | InChI=1S/C52H36N4OSi.Pt/c1-52(2,3)37-26-27-53-49(30-37)56-44-31-39(22-24-41(44)50-42(35-16-9-5-10-17-35)28-36(29-46(50)56)34-14-7-4-8-15-34)57-40-23-25-47-45(32-40)55-33-54(38-18-11-6-12-19-38)43-20-13-21-48(58-47)51(43)55;/h4-30H,1-3H3;/q-2; |
| InChIKey | ONTKQSUYZXFLQL-UHFFFAOYSA-N |
| XLogP | 10.19 |
| TPSA | 35.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 956.05 |
| LogP ≤ 5 | 10.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|