C21H23F3N4O2S2 — CID 16537592
1-[2,5-dimethyl-1-(2,2,2-trifluoroethyl)pyrrol-3-yl]-2-[[4-(oxolan-2-ylmethyl)-5-thiophen-2-yl-1,2,4-triazol-3-yl]sulfanyl]ethanone (PubChem CID 16537592) has the molecular formula C21H23F3N4O2S2 and a molecular weight of 484.57 g/mol. Its IUPAC name is 1-[2,5-dimethyl-1-(2,2,2-trifluoroethyl)pyrrol-3-yl]-2-[[4-(oxolan-2-ylmethyl)-5-thiophen-2-yl-1,2,4-triazol-3-yl]sulfanyl]ethanone.
| Compound Name | 1-[2,5-dimethyl-1-(2,2,2-trifluoroethyl)pyrrol-3-yl]-2-[[4-(oxolan-2-ylmethyl)-5-thiophen-2-yl-1,2,4-triazol-3-yl]sulfanyl]ethanone |
|---|---|
| PubChem CID | 16537592 |
| Molecular Formula | C21H23F3N4O2S2 |
| Molecular Weight | 484.57 g/mol |
| Exact Mass | 484.12 |
| IUPAC Name | 1-[2,5-dimethyl-1-(2,2,2-trifluoroethyl)pyrrol-3-yl]-2-[[4-(oxolan-2-ylmethyl)-5-thiophen-2-yl-1,2,4-triazol-3-yl]sulfanyl]ethanone |
| SMILES | Cc1cc(C(=O)CSc2nnc(-c3cccs3)n2CC2CCCO2)c(C)n1CC(F)(F)F |
| InChI | InChI=1S/C21H23F3N4O2S2/c1-13-9-16(14(2)28(13)12-21(22,23)24)17(29)11-32-20-26-25-19(18-6-4-8-31-18)27(20)10-15-5-3-7-30-15/h4,6,8-9,15H,3,5,7,10-12H2,1-2H3 |
| InChIKey | NOODTPKHTGJRSB-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 61.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.57 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |