C17H21F3N4O3S — CID 40882566
3-[2-[2,5-dimethyl-1-(2,2,2-trifluoroethyl)pyrrol-3-yl]-2-oxoethyl]sulfanyl-4-[[(2S)-oxolan-2-yl]methyl]-1H-1,2,4-triazol-5-one (PubChem CID 40882566) has the molecular formula C17H21F3N4O3S and a molecular weight of 418.44 g/mol. Its IUPAC name is 3-[2-[2,5-dimethyl-1-(2,2,2-trifluoroethyl)pyrrol-3-yl]-2-oxoethyl]sulfanyl-4-[[(2S)-oxolan-2-yl]methyl]-1H-1,2,4-triazol-5-one.
| Compound Name | 3-[2-[2,5-dimethyl-1-(2,2,2-trifluoroethyl)pyrrol-3-yl]-2-oxoethyl]sulfanyl-4-[[(2S)-oxolan-2-yl]methyl]-1H-1,2,4-triazol-5-one |
|---|---|
| PubChem CID | 40882566 |
| Molecular Formula | C17H21F3N4O3S |
| Molecular Weight | 418.44 g/mol |
| Exact Mass | 418.13 |
| IUPAC Name | 3-[2-[2,5-dimethyl-1-(2,2,2-trifluoroethyl)pyrrol-3-yl]-2-oxoethyl]sulfanyl-4-[[(2S)-oxolan-2-yl]methyl]-1H-1,2,4-triazol-5-one |
| SMILES | Cc1cc(C(=O)CSc2n[nH]c(=O)n2C[C@@H]2CCCO2)c(C)n1CC(F)(F)F |
| InChI | InChI=1S/C17H21F3N4O3S/c1-10-6-13(11(2)24(10)9-17(18,19)20)14(25)8-28-16-22-21-15(26)23(16)7-12-4-3-5-27-12/h6,12H,3-5,7-9H2,1-2H3,(H,21,26)/t12-/m0/s1 |
| InChIKey | SAXBJFNZTMGFBX-LBPRGKRZSA-N |
| XLogP | 2.71 |
| TPSA | 81.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.44 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |