C48H28N4 — CID 165376062
3-[4-[7-(4,6-diphenyl-1,3,5-triazin-2-yl)naphthalen-2-yl]fluoranthen-3-yl]benzonitrile (PubChem CID 165376062) has the molecular formula C48H28N4 and a molecular weight of 660.78 g/mol. Its IUPAC name is 3-[4-[7-(4,6-diphenyl-1,3,5-triazin-2-yl)naphthalen-2-yl]fluoranthen-3-yl]benzonitrile.
| Compound Name | 3-[4-[7-(4,6-diphenyl-1,3,5-triazin-2-yl)naphthalen-2-yl]fluoranthen-3-yl]benzonitrile |
|---|---|
| PubChem CID | 165376062 |
| Molecular Formula | C48H28N4 |
| Molecular Weight | 660.78 g/mol |
| Exact Mass | 660.23 |
| IUPAC Name | 3-[4-[7-(4,6-diphenyl-1,3,5-triazin-2-yl)naphthalen-2-yl]fluoranthen-3-yl]benzonitrile |
| SMILES | N#Cc1cccc(-c2ccc3c4c(ccc(-c5ccc6ccc(-c7nc(-c8ccccc8)nc(-c8ccccc8)n7)cc6c5)c24)-c2ccccc2-3)c1 |
| InChI | InChI=1S/C48H28N4/c49-29-30-10-9-15-34(26-30)38-22-24-42-40-16-7-8-17-41(40)43-25-23-39(44(38)45(42)43)35-20-18-31-19-21-36(28-37(31)27-35)48-51-46(32-11-3-1-4-12-32)50-47(52-48)33-13-5-2-6-14-33/h1-28H |
| InChIKey | JISOJXNESPJCIJ-UHFFFAOYSA-N |
| XLogP | 12.03 |
| TPSA | 62.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.78 |
| LogP ≤ 5 | 12.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |