C23H19Li — CID 165376734
lithium 6-methyl-8-naphthalen-1-yl-1,2,3,5-tetrahydro-s-indacen-5-ide (PubChem CID 165376734) has the molecular formula C23H19Li and a molecular weight of 302.35 g/mol. Its IUPAC name is lithium 6-methyl-8-naphthalen-1-yl-1,2,3,5-tetrahydro-s-indacen-5-ide.
| Compound Name | lithium 6-methyl-8-naphthalen-1-yl-1,2,3,5-tetrahydro-s-indacen-5-ide |
|---|---|
| PubChem CID | 165376734 |
| Molecular Formula | C23H19Li |
| Molecular Weight | 302.35 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | lithium 6-methyl-8-naphthalen-1-yl-1,2,3,5-tetrahydro-s-indacen-5-ide |
| SMILES | Cc1cc2c(-c3cccc4ccccc34)c3c(cc2[cH-]1)CCC3.[Li+] |
| InChI | InChI=1S/C23H19.Li/c1-15-12-18-14-17-8-5-10-20(17)23(22(18)13-15)21-11-4-7-16-6-2-3-9-19(16)21;/h2-4,6-7,9,11-14H,5,8,10H2,1H3;/q-1;+1 |
| InChIKey | MMOMFUTVDKUHME-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.35 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|