C35H30Cl2Zr — CID 162767498
dichlorozirconium(2+);2-methyl-4-phenyl-1H-inden-1-ide;6-methyl-8-phenyl-1,2,3,5-tetrahydro-s-indacen-5-ide (PubChem CID 162767498) has the molecular formula C35H30Cl2Zr and a molecular weight of 612.76 g/mol. Its IUPAC name is dichlorozirconium(2+);2-methyl-4-phenyl-1H-inden-1-ide;6-methyl-8-phenyl-1,2,3,5-tetrahydro-s-indacen-5-ide.
| Compound Name | dichlorozirconium(2+);2-methyl-4-phenyl-1H-inden-1-ide;6-methyl-8-phenyl-1,2,3,5-tetrahydro-s-indacen-5-ide |
|---|---|
| PubChem CID | 162767498 |
| Molecular Formula | C35H30Cl2Zr |
| Molecular Weight | 612.76 g/mol |
| Exact Mass | 610.08 |
| IUPAC Name | dichlorozirconium(2+);2-methyl-4-phenyl-1H-inden-1-ide;6-methyl-8-phenyl-1,2,3,5-tetrahydro-s-indacen-5-ide |
| SMILES | Cc1cc2c(-c3ccccc3)c3c(cc2[cH-]1)CCC3.Cc1cc2c(-c3ccccc3)cccc2[cH-]1.Cl[Zr+2]Cl |
| InChI | InChI=1S/C19H17.C16H13.2ClH.Zr/c1-13-10-16-12-15-8-5-9-17(15)19(18(16)11-13)14-6-3-2-4-7-14;1-12-10-14-8-5-9-15(16(14)11-12)13-6-3-2-4-7-13;;;/h2-4,6-7,10-12H,5,8-9H2,1H3;2-11H,1H3;2*1H;/q2*-1;;;+4/p-2 |
| InChIKey | KFVFHRYLYUSNBS-UHFFFAOYSA-L |
| XLogP | 10.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.76 |
| LogP ≤ 5 | 10.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|