C35H27NO2 — CID 165377258
3-[4-(1,8-dimethylcarbazol-9-yl)phenyl]-2,7-dimethylxanthen-9-one (PubChem CID 165377258) has the molecular formula C35H27NO2 and a molecular weight of 493.61 g/mol. Its IUPAC name is 3-[4-(1,8-dimethylcarbazol-9-yl)phenyl]-2,7-dimethylxanthen-9-one.
| Compound Name | 3-[4-(1,8-dimethylcarbazol-9-yl)phenyl]-2,7-dimethylxanthen-9-one |
|---|---|
| PubChem CID | 165377258 |
| Molecular Formula | C35H27NO2 |
| Molecular Weight | 493.61 g/mol |
| Exact Mass | 493.20 |
| IUPAC Name | 3-[4-(1,8-dimethylcarbazol-9-yl)phenyl]-2,7-dimethylxanthen-9-one |
| SMILES | Cc1ccc2oc3cc(-c4ccc(-n5c6c(C)cccc6c6cccc(C)c65)cc4)c(C)cc3c(=O)c2c1 |
| InChI | InChI=1S/C35H27NO2/c1-20-11-16-31-29(17-20)35(37)30-18-23(4)28(19-32(30)38-31)24-12-14-25(15-13-24)36-33-21(2)7-5-9-26(33)27-10-6-8-22(3)34(27)36/h5-19H,1-4H3 |
| InChIKey | OVMIRKDQMSCCLT-UHFFFAOYSA-N |
| XLogP | 8.94 |
| TPSA | 35.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.61 |
| LogP ≤ 5 | 8.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|