C24H20N4O2S3 — CID 16537768
2-[2-(3,5-dithiophen-2-yl-3,4-dihydropyrazol-2-yl)-2-oxoethyl]sulfanyl-3-prop-2-enylquinazolin-4-one (PubChem CID 16537768) has the molecular formula C24H20N4O2S3 and a molecular weight of 492.65 g/mol. Its IUPAC name is 2-[2-(3,5-dithiophen-2-yl-3,4-dihydropyrazol-2-yl)-2-oxoethyl]sulfanyl-3-prop-2-enylquinazolin-4-one.
| Compound Name | 2-[2-(3,5-dithiophen-2-yl-3,4-dihydropyrazol-2-yl)-2-oxoethyl]sulfanyl-3-prop-2-enylquinazolin-4-one |
|---|---|
| PubChem CID | 16537768 |
| Molecular Formula | C24H20N4O2S3 |
| Molecular Weight | 492.65 g/mol |
| Exact Mass | 492.07 |
| IUPAC Name | 2-[2-(3,5-dithiophen-2-yl-3,4-dihydropyrazol-2-yl)-2-oxoethyl]sulfanyl-3-prop-2-enylquinazolin-4-one |
| SMILES | C=CCn1c(SCC(=O)N2N=C(c3cccs3)CC2c2cccs2)nc2ccccc2c1=O |
| InChI | InChI=1S/C24H20N4O2S3/c1-2-11-27-23(30)16-7-3-4-8-17(16)25-24(27)33-15-22(29)28-19(21-10-6-13-32-21)14-18(26-28)20-9-5-12-31-20/h2-10,12-13,19H,1,11,14-15H2 |
| InChIKey | OXODYWGOAOQJRZ-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 67.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.65 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|