C16H23N3O — CID 165380007
5-methyl-3-[[4-(4-methylphenyl)piperazin-1-yl]methyl]-2,3-dihydro-1,2-oxazole (PubChem CID 165380007) has the molecular formula C16H23N3O and a molecular weight of 273.38 g/mol. Its IUPAC name is 5-methyl-3-[[4-(4-methylphenyl)piperazin-1-yl]methyl]-2,3-dihydro-1,2-oxazole.
| Compound Name | 5-methyl-3-[[4-(4-methylphenyl)piperazin-1-yl]methyl]-2,3-dihydro-1,2-oxazole |
|---|---|
| PubChem CID | 165380007 |
| Molecular Formula | C16H23N3O |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.18 |
| IUPAC Name | 5-methyl-3-[[4-(4-methylphenyl)piperazin-1-yl]methyl]-2,3-dihydro-1,2-oxazole |
| SMILES | CC1=CC(CN2CCN(c3ccc(C)cc3)CC2)NO1 |
| InChI | InChI=1S/C16H23N3O/c1-13-3-5-16(6-4-13)19-9-7-18(8-10-19)12-15-11-14(2)20-17-15/h3-6,11,15,17H,7-10,12H2,1-2H3 |
| InChIKey | PCQISYCGXSDUCG-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|