C51H38N2 — CID 165384236
9,9-dimethyl-N-[2,3,4,6-tetradeuterio-5-(9-phenylcarbazol-3-yl)phenyl]-N-[2,3,4-trideuterio-6-(2,3,4,5,6-pentadeuteriophenyl)phenyl]fluoren-2-amine (PubChem CID 165384236) has the molecular formula C51H38N2 and a molecular weight of 690.95 g/mol. Its IUPAC name is 9,9-dimethyl-N-[2,3,4,6-tetradeuterio-5-(9-phenylcarbazol-3-yl)phenyl]-N-[2,3,4-trideuterio-6-(2,3,4,5,6-pentadeuteriophenyl)phenyl]fluoren-2-amine.
| Compound Name | 9,9-dimethyl-N-[2,3,4,6-tetradeuterio-5-(9-phenylcarbazol-3-yl)phenyl]-N-[2,3,4-trideuterio-6-(2,3,4,5,6-pentadeuteriophenyl)phenyl]fluoren-2-amine |
|---|---|
| PubChem CID | 165384236 |
| Molecular Formula | C51H38N2 |
| Molecular Weight | 690.95 g/mol |
| Exact Mass | 690.38 |
| IUPAC Name | 9,9-dimethyl-N-[2,3,4,6-tetradeuterio-5-(9-phenylcarbazol-3-yl)phenyl]-N-[2,3,4-trideuterio-6-(2,3,4,5,6-pentadeuteriophenyl)phenyl]fluoren-2-amine |
| SMILES | [2H]c1cc(-c2c([2H])c([2H])c([2H])c([2H])c2[2H])c(N(c2ccc3c(c2)C(C)(C)c2ccccc2-3)c2c([2H])c([2H])c([2H])c(-c3ccc4c(c3)c3ccccc3n4-c3ccccc3)c2[2H])c([2H])c1[2H] |
| InChI | InChI=1S/C51H38N2/c1-51(2)46-25-12-9-23-42(46)43-30-29-40(34-47(43)51)52(48-26-13-10-22-41(48)35-16-5-3-6-17-35)39-21-15-18-36(32-39)37-28-31-50-45(33-37)44-24-11-14-27-49(44)53(50)38-19-7-4-8-20-38/h3-34H,1-2H3/i3D,5D,6D,10D,13D,15D,16D,17D,18D,21D,26D,32D |
| InChIKey | FHXWSPWQODHFFD-RXHJTPBPSA-N |
| XLogP | 13.89 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.95 |
| LogP ≤ 5 | 13.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |