C27H26FN3O3 — CID 165385255
5-[2-ethoxy-4-[1H-indol-7-ylmethyl(methyl)carbamoyl]phenyl]-2-fluoro-N-methylbenzamide (PubChem CID 165385255) has the molecular formula C27H26FN3O3 and a molecular weight of 459.52 g/mol. Its IUPAC name is 5-[2-ethoxy-4-[1H-indol-7-ylmethyl(methyl)carbamoyl]phenyl]-2-fluoro-N-methylbenzamide.
| Compound Name | 5-[2-ethoxy-4-[1H-indol-7-ylmethyl(methyl)carbamoyl]phenyl]-2-fluoro-N-methylbenzamide |
|---|---|
| PubChem CID | 165385255 |
| Molecular Formula | C27H26FN3O3 |
| Molecular Weight | 459.52 g/mol |
| Exact Mass | 459.20 |
| IUPAC Name | 5-[2-ethoxy-4-[1H-indol-7-ylmethyl(methyl)carbamoyl]phenyl]-2-fluoro-N-methylbenzamide |
| SMILES | CCOc1cc(C(=O)N(C)Cc2cccc3cc[nH]c23)ccc1-c1ccc(F)c(C(=O)NC)c1 |
| InChI | InChI=1S/C27H26FN3O3/c1-4-34-24-15-19(8-10-21(24)18-9-11-23(28)22(14-18)26(32)29-2)27(33)31(3)16-20-7-5-6-17-12-13-30-25(17)20/h5-15,30H,4,16H2,1-3H3,(H,29,32) |
| InChIKey | CPAKSAQHGVJQPY-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.52 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |