C21H20FN5O2 — CID 165385291
2-ethoxy-1-(3-fluorophenyl)-N-(1H-indazol-7-ylmethyl)-N-methylimidazole-4-carboxamide (PubChem CID 165385291) has the molecular formula C21H20FN5O2 and a molecular weight of 393.42 g/mol. Its IUPAC name is 2-ethoxy-1-(3-fluorophenyl)-N-(1H-indazol-7-ylmethyl)-N-methylimidazole-4-carboxamide.
| Compound Name | 2-ethoxy-1-(3-fluorophenyl)-N-(1H-indazol-7-ylmethyl)-N-methylimidazole-4-carboxamide |
|---|---|
| PubChem CID | 165385291 |
| Molecular Formula | C21H20FN5O2 |
| Molecular Weight | 393.42 g/mol |
| Exact Mass | 393.16 |
| IUPAC Name | 2-ethoxy-1-(3-fluorophenyl)-N-(1H-indazol-7-ylmethyl)-N-methylimidazole-4-carboxamide |
| SMILES | CCOc1nc(C(=O)N(C)Cc2cccc3cn[nH]c23)cn1-c1cccc(F)c1 |
| InChI | InChI=1S/C21H20FN5O2/c1-3-29-21-24-18(13-27(21)17-9-5-8-16(22)10-17)20(28)26(2)12-15-7-4-6-14-11-23-25-19(14)15/h4-11,13H,3,12H2,1-2H3,(H,23,25) |
| InChIKey | GKNQWIJTTUMFTN-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 76.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.42 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |