C24H21N5O2 — CID 165385357
6-ethoxy-N-(1H-indazol-7-ylmethyl)-5-(4-isocyanophenyl)-N-methylpyridine-2-carboxamide (PubChem CID 165385357) has the molecular formula C24H21N5O2 and a molecular weight of 411.47 g/mol. Its IUPAC name is 6-ethoxy-N-(1H-indazol-7-ylmethyl)-5-(4-isocyanophenyl)-N-methylpyridine-2-carboxamide.
| Compound Name | 6-ethoxy-N-(1H-indazol-7-ylmethyl)-5-(4-isocyanophenyl)-N-methylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 165385357 |
| Molecular Formula | C24H21N5O2 |
| Molecular Weight | 411.47 g/mol |
| Exact Mass | 411.17 |
| IUPAC Name | 6-ethoxy-N-(1H-indazol-7-ylmethyl)-5-(4-isocyanophenyl)-N-methylpyridine-2-carboxamide |
| SMILES | [C-]#[N+]c1ccc(-c2ccc(C(=O)N(C)Cc3cccc4cn[nH]c34)nc2OCC)cc1 |
| InChI | InChI=1S/C24H21N5O2/c1-4-31-23-20(16-8-10-19(25-2)11-9-16)12-13-21(27-23)24(30)29(3)15-18-7-5-6-17-14-26-28-22(17)18/h5-14H,4,15H2,1,3H3,(H,26,28) |
| InChIKey | SKCYGPYGCXQSKH-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 75.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.47 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|