C23H21F3N4O2 — CID 165386721
4-[[(1R)-1-[2-methyl-3-(trifluoromethyl)phenyl]prop-2-ynyl]amino]-6-(oxan-4-yl)pyrido[4,3-d]pyrimidin-7-one (PubChem CID 165386721) has the molecular formula C23H21F3N4O2 and a molecular weight of 442.44 g/mol. Its IUPAC name is 4-[[(1R)-1-[2-methyl-3-(trifluoromethyl)phenyl]prop-2-ynyl]amino]-6-(oxan-4-yl)pyrido[4,3-d]pyrimidin-7-one.
| Compound Name | 4-[[(1R)-1-[2-methyl-3-(trifluoromethyl)phenyl]prop-2-ynyl]amino]-6-(oxan-4-yl)pyrido[4,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 165386721 |
| Molecular Formula | C23H21F3N4O2 |
| Molecular Weight | 442.44 g/mol |
| Exact Mass | 442.16 |
| IUPAC Name | 4-[[(1R)-1-[2-methyl-3-(trifluoromethyl)phenyl]prop-2-ynyl]amino]-6-(oxan-4-yl)pyrido[4,3-d]pyrimidin-7-one |
| SMILES | C#C[C@@H](Nc1ncnc2cc(=O)n(C3CCOCC3)cc12)c1cccc(C(F)(F)F)c1C |
| InChI | InChI=1S/C23H21F3N4O2/c1-3-19(16-5-4-6-18(14(16)2)23(24,25)26)29-22-17-12-30(15-7-9-32-10-8-15)21(31)11-20(17)27-13-28-22/h1,4-6,11-13,15,19H,7-10H2,2H3,(H,27,28,29)/t19-/m1/s1 |
| InChIKey | QELFJLAXAKGKTN-LJQANCHMSA-N |
| XLogP | 4.26 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.44 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|