C27H24N6O2 — CID 165389052
1-[(2S)-2-[8-amino-1-(4-anilinobenzoyl)imidazo[1,5-a]pyrazin-3-yl]pyrrolidin-1-yl]but-2-yn-1-one (PubChem CID 165389052) has the molecular formula C27H24N6O2 and a molecular weight of 464.53 g/mol. Its IUPAC name is 1-[(2S)-2-[8-amino-1-(4-anilinobenzoyl)imidazo[1,5-a]pyrazin-3-yl]pyrrolidin-1-yl]but-2-yn-1-one.
| Compound Name | 1-[(2S)-2-[8-amino-1-(4-anilinobenzoyl)imidazo[1,5-a]pyrazin-3-yl]pyrrolidin-1-yl]but-2-yn-1-one |
|---|---|
| PubChem CID | 165389052 |
| Molecular Formula | C27H24N6O2 |
| Molecular Weight | 464.53 g/mol |
| Exact Mass | 464.20 |
| IUPAC Name | 1-[(2S)-2-[8-amino-1-(4-anilinobenzoyl)imidazo[1,5-a]pyrazin-3-yl]pyrrolidin-1-yl]but-2-yn-1-one |
| SMILES | CC#CC(=O)N1CCC[C@H]1c1nc(C(=O)c2ccc(Nc3ccccc3)cc2)c2c(N)nccn12 |
| InChI | InChI=1S/C27H24N6O2/c1-2-7-22(34)32-16-6-10-21(32)27-31-23(24-26(28)29-15-17-33(24)27)25(35)18-11-13-20(14-12-18)30-19-8-4-3-5-9-19/h3-5,8-9,11-15,17,21,30H,6,10,16H2,1H3,(H2,28,29)/t21-/m0/s1 |
| InChIKey | MYGBZNBYJYUIBZ-NRFANRHFSA-N |
| XLogP | 3.97 |
| TPSA | 105.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.53 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|