acetic acid;silicic acid;zinc

C2H8O6SiZn — CID 165390291

IUPACacetic acid;silicic acid;zinc
SMILESCC(=O)O.O[Si](O)(O)O.[Zn]
InChIInChI=1S/C2H4O2.H4O4Si.Zn/c1-2(3)4;1-5(2,3)4;/h1H3,(H,3,4);1-4H;
InChIKeyNHFGCRGMMSPBSY-UHFFFAOYSA-N
MW221.56 g/mol
LogP-2.52
Rot. Bonds

About acetic acid;silicic acid;zinc

acetic acid;silicic acid;zinc (PubChem CID 165390291) has the molecular formula C2H8O6SiZn and a molecular weight of 221.56 g/mol. Its IUPAC name is acetic acid;silicic acid;zinc.

Molecular Properties

Compound Nameacetic acid;silicic acid;zinc
PubChem CID165390291
Molecular FormulaC2H8O6SiZn
Molecular Weight221.56 g/mol
Exact Mass219.94
IUPAC Nameacetic acid;silicic acid;zinc
SMILESCC(=O)O.O[Si](O)(O)O.[Zn]
InChIInChI=1S/C2H4O2.H4O4Si.Zn/c1-2(3)4;1-5(2,3)4;/h1H3,(H,3,4);1-4H;
InChIKeyNHFGCRGMMSPBSY-UHFFFAOYSA-N
XLogP-2.52
TPSA118.22 Ų
H-Bond Donors5
H-Bond Acceptors5
Rotatable Bonds
Heavy Atoms10
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500221.56
LogP ≤ 5-2.52
H-Bond Donors ≤ 55
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze acetic acid;silicic acid;zinc with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of acetic acid;silicic acid;zinc?
The IUPAC name of acetic acid;silicic acid;zinc (CID 165390291) is acetic acid;silicic acid;zinc.
What is the SMILES notation for acetic acid;silicic acid;zinc?
The canonical SMILES for acetic acid;silicic acid;zinc is CC(=O)O.O[Si](O)(O)O.[Zn].
What is the InChIKey of acetic acid;silicic acid;zinc?
The InChIKey is NHFGCRGMMSPBSY-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H4O2.H4O4Si.Zn/c1-2(3)4;1-5(2,3)4;/h1H3,(H,3,4);1-4H;.
What are the key properties of acetic acid;silicic acid;zinc?
acetic acid;silicic acid;zinc has a molecular weight of 221.56 g/mol, XLogP of -2.52, 0 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;silicic acid;zinc is sourced from PubChem (CID 165390291), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).