About acetic acid;silicic acid;zinc
acetic acid;silicic acid;zinc (PubChem CID 165390291) has the molecular formula C2H8O6SiZn
and a molecular weight of 221.56 g/mol. Its IUPAC name is acetic acid;silicic acid;zinc.
Molecular Properties
| Compound Name | acetic acid;silicic acid;zinc |
| PubChem CID | 165390291 |
| Molecular Formula | C2H8O6SiZn |
| Molecular Weight | 221.56 g/mol |
| Exact Mass | 219.94 |
| IUPAC Name | acetic acid;silicic acid;zinc |
| SMILES | CC(=O)O.O[Si](O)(O)O.[Zn] |
| InChI | InChI=1S/C2H4O2.H4O4Si.Zn/c1-2(3)4;1-5(2,3)4;/h1H3,(H,3,4);1-4H; |
| InChIKey | NHFGCRGMMSPBSY-UHFFFAOYSA-N |
| XLogP | -2.52 |
| TPSA | 118.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.56 |
| LogP ≤ 5 | -2.52 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze acetic acid;silicic acid;zinc with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;silicic acid;zinc?
The IUPAC name of acetic acid;silicic acid;zinc (CID 165390291) is acetic acid;silicic acid;zinc.
What is the SMILES notation for acetic acid;silicic acid;zinc?
The canonical SMILES for acetic acid;silicic acid;zinc is CC(=O)O.O[Si](O)(O)O.[Zn].
What is the InChIKey of acetic acid;silicic acid;zinc?
The InChIKey is NHFGCRGMMSPBSY-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H4O2.H4O4Si.Zn/c1-2(3)4;1-5(2,3)4;/h1H3,(H,3,4);1-4H;.
What are the key properties of acetic acid;silicic acid;zinc?
acetic acid;silicic acid;zinc has a molecular weight of 221.56 g/mol, XLogP of -2.52, 0 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;silicic acid;zinc is sourced from PubChem (CID 165390291), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).