carbonic acid;silicic acid

CH10O11Si2 — CID 87379550

IUPACcarbonic acid;silicic acid
SMILESO=C(O)O.O[Si](O)(O)O.O[Si](O)(O)O
InChIInChI=1S/CH2O3.2H4O4Si/c2-1(3)4;2*1-5(2,3)4/h(H2,2,3,4);2*1-4H
InChIKeyQTGWFKJNIMYFGL-UHFFFAOYSA-N
MW254.25 g/mol
LogP-5.00
Rot. Bonds

About carbonic acid;silicic acid

carbonic acid;silicic acid (PubChem CID 87379550) has the molecular formula CH10O11Si2 and a molecular weight of 254.25 g/mol. Its IUPAC name is carbonic acid;silicic acid.

Molecular Properties

Compound Namecarbonic acid;silicic acid
PubChem CID87379550
Molecular FormulaCH10O11Si2
Molecular Weight254.25 g/mol
Exact Mass253.98
IUPAC Namecarbonic acid;silicic acid
SMILESO=C(O)O.O[Si](O)(O)O.O[Si](O)(O)O
InChIInChI=1S/CH2O3.2H4O4Si/c2-1(3)4;2*1-5(2,3)4/h(H2,2,3,4);2*1-4H
InChIKeyQTGWFKJNIMYFGL-UHFFFAOYSA-N
XLogP-5.00
TPSA219.37 Ų
H-Bond Donors10
H-Bond Acceptors9
Rotatable Bonds
Heavy Atoms14
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500254.25
LogP ≤ 5-5.00
H-Bond Donors ≤ 510
H-Bond Acceptors ≤ 109

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze carbonic acid;silicic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of carbonic acid;silicic acid?
The IUPAC name of carbonic acid;silicic acid (CID 87379550) is carbonic acid;silicic acid.
What is the SMILES notation for carbonic acid;silicic acid?
The canonical SMILES for carbonic acid;silicic acid is O=C(O)O.O[Si](O)(O)O.O[Si](O)(O)O.
What is the InChIKey of carbonic acid;silicic acid?
The InChIKey is QTGWFKJNIMYFGL-UHFFFAOYSA-N. The full InChI is InChI=1S/CH2O3.2H4O4Si/c2-1(3)4;2*1-5(2,3)4/h(H2,2,3,4);2*1-4H.
What are the key properties of carbonic acid;silicic acid?
carbonic acid;silicic acid has a molecular weight of 254.25 g/mol, XLogP of -5.00, 0 rotatable bonds, 10 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for carbonic acid;silicic acid is sourced from PubChem (CID 87379550), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).