About carbonic acid;silicic acid
carbonic acid;silicic acid (PubChem CID 87379550) has the molecular formula CH10O11Si2
and a molecular weight of 254.25 g/mol. Its IUPAC name is carbonic acid;silicic acid.
Molecular Properties
| Compound Name | carbonic acid;silicic acid |
| PubChem CID | 87379550 |
| Molecular Formula | CH10O11Si2 |
| Molecular Weight | 254.25 g/mol |
| Exact Mass | 253.98 |
| IUPAC Name | carbonic acid;silicic acid |
| SMILES | O=C(O)O.O[Si](O)(O)O.O[Si](O)(O)O |
| InChI | InChI=1S/CH2O3.2H4O4Si/c2-1(3)4;2*1-5(2,3)4/h(H2,2,3,4);2*1-4H |
| InChIKey | QTGWFKJNIMYFGL-UHFFFAOYSA-N |
| XLogP | -5.00 |
| TPSA | 219.37 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 254.25 |
| LogP ≤ 5 | -5.00 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze carbonic acid;silicic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbonic acid;silicic acid?
The IUPAC name of carbonic acid;silicic acid (CID 87379550) is carbonic acid;silicic acid.
What is the SMILES notation for carbonic acid;silicic acid?
The canonical SMILES for carbonic acid;silicic acid is O=C(O)O.O[Si](O)(O)O.O[Si](O)(O)O.
What is the InChIKey of carbonic acid;silicic acid?
The InChIKey is QTGWFKJNIMYFGL-UHFFFAOYSA-N. The full InChI is InChI=1S/CH2O3.2H4O4Si/c2-1(3)4;2*1-5(2,3)4/h(H2,2,3,4);2*1-4H.
What are the key properties of carbonic acid;silicic acid?
carbonic acid;silicic acid has a molecular weight of 254.25 g/mol, XLogP of -5.00, 0 rotatable bonds, 10 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for carbonic acid;silicic acid is sourced from PubChem (CID 87379550), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).