About carbonic acid;molybdenum
carbonic acid;molybdenum (PubChem CID 87095974) has the molecular formula CH2MoO3
and a molecular weight of 157.96 g/mol. Its IUPAC name is carbonic acid;molybdenum.
Molecular Properties
| Compound Name | carbonic acid;molybdenum |
| PubChem CID | 87095974 |
| Molecular Formula | CH2MoO3 |
| Molecular Weight | 157.96 g/mol |
| Exact Mass | 159.91 |
| IUPAC Name | carbonic acid;molybdenum |
| SMILES | O=C(O)O.[Mo] |
| InChI | InChI=1S/CH2O3.Mo/c2-1(3)4;/h(H2,2,3,4); |
| InChIKey | STZJANGYOWJEPH-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.96 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze carbonic acid;molybdenum with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbonic acid;molybdenum?
The IUPAC name of carbonic acid;molybdenum (CID 87095974) is carbonic acid;molybdenum.
What is the SMILES notation for carbonic acid;molybdenum?
The canonical SMILES for carbonic acid;molybdenum is O=C(O)O.[Mo].
What is the InChIKey of carbonic acid;molybdenum?
The InChIKey is STZJANGYOWJEPH-UHFFFAOYSA-N. The full InChI is InChI=1S/CH2O3.Mo/c2-1(3)4;/h(H2,2,3,4);.
What are the key properties of carbonic acid;molybdenum?
carbonic acid;molybdenum has a molecular weight of 157.96 g/mol, XLogP of 0.22, 0 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for carbonic acid;molybdenum is sourced from PubChem (CID 87095974), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).