About calcium;carbonic acid;dibromide
calcium;carbonic acid;dibromide (PubChem CID 174832519) has the molecular formula CH2Br2CaO3
and a molecular weight of 261.91 g/mol. Its IUPAC name is calcium;carbonic acid;dibromide.
Molecular Properties
| Compound Name | calcium;carbonic acid;dibromide |
| PubChem CID | 174832519 |
| Molecular Formula | CH2Br2CaO3 |
| Molecular Weight | 261.91 g/mol |
| Exact Mass | 259.80 |
| IUPAC Name | calcium;carbonic acid;dibromide |
| SMILES | O=C(O)O.[Br-].[Br-].[Ca+2] |
| InChI | InChI=1S/CH2O3.2BrH.Ca/c2-1(3)4;;;/h(H2,2,3,4);2*1H;/q;;;+2/p-2 |
| InChIKey | KJLWTMZADCMOMV-UHFFFAOYSA-L |
| XLogP | -6.15 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.91 |
| LogP ≤ 5 | -6.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze calcium;carbonic acid;dibromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of calcium;carbonic acid;dibromide?
The IUPAC name of calcium;carbonic acid;dibromide (CID 174832519) is calcium;carbonic acid;dibromide.
What is the SMILES notation for calcium;carbonic acid;dibromide?
The canonical SMILES for calcium;carbonic acid;dibromide is O=C(O)O.[Br-].[Br-].[Ca+2].
What is the InChIKey of calcium;carbonic acid;dibromide?
The InChIKey is KJLWTMZADCMOMV-UHFFFAOYSA-L. The full InChI is InChI=1S/CH2O3.2BrH.Ca/c2-1(3)4;;;/h(H2,2,3,4);2*1H;/q;;;+2/p-2.
What are the key properties of calcium;carbonic acid;dibromide?
calcium;carbonic acid;dibromide has a molecular weight of 261.91 g/mol, XLogP of -6.15, 0 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for calcium;carbonic acid;dibromide is sourced from PubChem (CID 174832519), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).