About carbonic acid;selane
carbonic acid;selane (PubChem CID 174299028) has the molecular formula CH6O3Se2
and a molecular weight of 223.98 g/mol. Its IUPAC name is carbonic acid;selane.
Molecular Properties
| Compound Name | carbonic acid;selane |
| PubChem CID | 174299028 |
| Molecular Formula | CH6O3Se2 |
| Molecular Weight | 223.98 g/mol |
| Exact Mass | 225.86 |
| IUPAC Name | carbonic acid;selane |
| SMILES | O=C(O)O.[SeH2].[SeH2] |
| InChI | InChI=1S/CH2O3.2H2Se/c2-1(3)4;;/h(H2,2,3,4);2*1H2 |
| InChIKey | SLHGITDCZMKNTF-UHFFFAOYSA-N |
| XLogP | -1.61 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.98 |
| LogP ≤ 5 | -1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze carbonic acid;selane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbonic acid;selane?
The IUPAC name of carbonic acid;selane (CID 174299028) is carbonic acid;selane.
What is the SMILES notation for carbonic acid;selane?
The canonical SMILES for carbonic acid;selane is O=C(O)O.[SeH2].[SeH2].
What is the InChIKey of carbonic acid;selane?
The InChIKey is SLHGITDCZMKNTF-UHFFFAOYSA-N. The full InChI is InChI=1S/CH2O3.2H2Se/c2-1(3)4;;/h(H2,2,3,4);2*1H2.
What are the key properties of carbonic acid;selane?
carbonic acid;selane has a molecular weight of 223.98 g/mol, XLogP of -1.61, 0 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for carbonic acid;selane is sourced from PubChem (CID 174299028), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).