About azane;carbonic acid
azane;carbonic acid (PubChem CID 71309526) has the molecular formula CH8N2O3
and a molecular weight of 98.07 g/mol. Its IUPAC name is azane;carbonic acid.
Molecular Properties
| Compound Name | azane;carbonic acid |
| PubChem CID | 71309526 |
| Molecular Formula | CH8N2O3 |
| Molecular Weight | 98.07 g/mol |
| Exact Mass | 98.05 |
| IUPAC Name | azane;carbonic acid |
| SMILES | O=C(O)O.[15NH3].[15NH3] |
| InChI | InChI=1S/CH2O3.2H3N/c2-1(3)4;;/h(H2,2,3,4);2*1H3/i;2*1+1 |
| InChIKey | PRKQVKDSMLBJBJ-IMSGLENWSA-N |
| XLogP | 0.55 |
| TPSA | 127.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 98.07 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze azane;carbonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;carbonic acid?
The IUPAC name of azane;carbonic acid (CID 71309526) is azane;carbonic acid.
What is the SMILES notation for azane;carbonic acid?
The canonical SMILES for azane;carbonic acid is O=C(O)O.[15NH3].[15NH3].
What is the InChIKey of azane;carbonic acid?
The InChIKey is PRKQVKDSMLBJBJ-IMSGLENWSA-N. The full InChI is InChI=1S/CH2O3.2H3N/c2-1(3)4;;/h(H2,2,3,4);2*1H3/i;2*1+1.
What are the key properties of azane;carbonic acid?
azane;carbonic acid has a molecular weight of 98.07 g/mol, XLogP of 0.55, 0 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for azane;carbonic acid is sourced from PubChem (CID 71309526), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).