C9H8F5NO — CID 165394094
2-methylidene-4-(2,2,3,3,3-pentafluoropropoxy)-1H-pyridine (PubChem CID 165394094) has the molecular formula C9H8F5NO and a molecular weight of 241.16 g/mol. Its IUPAC name is 2-methylidene-4-(2,2,3,3,3-pentafluoropropoxy)-1H-pyridine.
| Compound Name | 2-methylidene-4-(2,2,3,3,3-pentafluoropropoxy)-1H-pyridine |
|---|---|
| PubChem CID | 165394094 |
| Molecular Formula | C9H8F5NO |
| Molecular Weight | 241.16 g/mol |
| Exact Mass | 241.05 |
| IUPAC Name | 2-methylidene-4-(2,2,3,3,3-pentafluoropropoxy)-1H-pyridine |
| SMILES | C=C1C=C(OCC(F)(F)C(F)(F)F)C=CN1 |
| InChI | InChI=1S/C9H8F5NO/c1-6-4-7(2-3-15-6)16-5-8(10,11)9(12,13)14/h2-4,15H,1,5H2 |
| InChIKey | NOJJRGFYELJNPN-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.16 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|