C8H10F3NO — CID 162557057
2-methanidyl-4-(2,2,2-trifluoroethoxy)-1,2-dihydropyridin-1-ium (PubChem CID 162557057) has the molecular formula C8H10F3NO and a molecular weight of 193.17 g/mol. Its IUPAC name is 2-methanidyl-4-(2,2,2-trifluoroethoxy)-1,2-dihydropyridin-1-ium.
| Compound Name | 2-methanidyl-4-(2,2,2-trifluoroethoxy)-1,2-dihydropyridin-1-ium |
|---|---|
| PubChem CID | 162557057 |
| Molecular Formula | C8H10F3NO |
| Molecular Weight | 193.17 g/mol |
| Exact Mass | 193.07 |
| IUPAC Name | 2-methanidyl-4-(2,2,2-trifluoroethoxy)-1,2-dihydropyridin-1-ium |
| SMILES | [CH2-]C1C=C(OCC(F)(F)F)C=C[NH2+]1 |
| InChI | InChI=1S/C8H9F3NO/c1-6-4-7(2-3-12-6)13-5-8(9,10)11/h2-4,6,12H,1,5H2/q-1/p+1 |
| InChIKey | JEKBOZXKMFLLJQ-UHFFFAOYSA-O |
| XLogP | 0.74 |
| TPSA | 25.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.17 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|