C22H21F2N5O4 — CID 165396195
(3R)-6-[7,7-difluoro-2-[(2S,3R)-3-hydroxy-2-methylazetidin-1-yl]-5,6-dihydrocyclopenta[d]pyrimidin-4-yl]-3'-methylspiro[2H-1-benzofuran-3,5'-imidazolidine]-2',4'-dione (PubChem CID 165396195) has the molecular formula C22H21F2N5O4 and a molecular weight of 457.44 g/mol. Its IUPAC name is (3R)-6-[7,7-difluoro-2-[(2S,3R)-3-hydroxy-2-methylazetidin-1-yl]-5,6-dihydrocyclopenta[d]pyrimidin-4-yl]-3'-methylspiro[2H-1-benzofuran-3,5'-imidazolidine]-2',4'-dione.
| Compound Name | (3R)-6-[7,7-difluoro-2-[(2S,3R)-3-hydroxy-2-methylazetidin-1-yl]-5,6-dihydrocyclopenta[d]pyrimidin-4-yl]-3'-methylspiro[2H-1-benzofuran-3,5'-imidazolidine]-2',4'-dione |
|---|---|
| PubChem CID | 165396195 |
| Molecular Formula | C22H21F2N5O4 |
| Molecular Weight | 457.44 g/mol |
| Exact Mass | 457.16 |
| IUPAC Name | (3R)-6-[7,7-difluoro-2-[(2S,3R)-3-hydroxy-2-methylazetidin-1-yl]-5,6-dihydrocyclopenta[d]pyrimidin-4-yl]-3'-methylspiro[2H-1-benzofuran-3,5'-imidazolidine]-2',4'-dione |
| SMILES | C[C@H]1[C@H](O)CN1c1nc(-c2ccc3c(c2)OC[C@]32NC(=O)N(C)C2=O)c2c(n1)C(F)(F)CC2 |
| InChI | InChI=1S/C22H21F2N5O4/c1-10-14(30)8-29(10)19-25-16(12-5-6-22(23,24)17(12)26-19)11-3-4-13-15(7-11)33-9-21(13)18(31)28(2)20(32)27-21/h3-4,7,10,14,30H,5-6,8-9H2,1-2H3,(H,27,32)/t10-,14+,21-/m0/s1 |
| InChIKey | LWHGJBINRZYXFE-TUAQGKDASA-N |
| XLogP | 1.52 |
| TPSA | 107.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.44 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|