C21H20F2N4O4 — CID 165397396
(4R)-6'-[7,7-difluoro-2-[(2S,3R)-3-hydroxy-2-methylazetidin-1-yl]-5,6-dihydrocyclopenta[d]pyrimidin-4-yl]spiro[1,3-oxazolidine-4,3'-2H-1-benzofuran]-2-one (PubChem CID 165397396) has the molecular formula C21H20F2N4O4 and a molecular weight of 430.41 g/mol. Its IUPAC name is (4R)-6'-[7,7-difluoro-2-[(2S,3R)-3-hydroxy-2-methylazetidin-1-yl]-5,6-dihydrocyclopenta[d]pyrimidin-4-yl]spiro[1,3-oxazolidine-4,3'-2H-1-benzofuran]-2-one.
| Compound Name | (4R)-6'-[7,7-difluoro-2-[(2S,3R)-3-hydroxy-2-methylazetidin-1-yl]-5,6-dihydrocyclopenta[d]pyrimidin-4-yl]spiro[1,3-oxazolidine-4,3'-2H-1-benzofuran]-2-one |
|---|---|
| PubChem CID | 165397396 |
| Molecular Formula | C21H20F2N4O4 |
| Molecular Weight | 430.41 g/mol |
| Exact Mass | 430.15 |
| IUPAC Name | (4R)-6'-[7,7-difluoro-2-[(2S,3R)-3-hydroxy-2-methylazetidin-1-yl]-5,6-dihydrocyclopenta[d]pyrimidin-4-yl]spiro[1,3-oxazolidine-4,3'-2H-1-benzofuran]-2-one |
| SMILES | C[C@H]1[C@H](O)CN1c1nc(-c2ccc3c(c2)OC[C@@]32COC(=O)N2)c2c(n1)C(F)(F)CC2 |
| InChI | InChI=1S/C21H20F2N4O4/c1-10-14(28)7-27(10)18-24-16(12-4-5-21(22,23)17(12)25-18)11-2-3-13-15(6-11)30-8-20(13)9-31-19(29)26-20/h2-3,6,10,14,28H,4-5,7-9H2,1H3,(H,26,29)/t10-,14+,20+/m0/s1 |
| InChIKey | WJDQAAXGCMFVPN-RLNQDPLASA-N |
| XLogP | 2.08 |
| TPSA | 96.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.41 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |