About [3-[2-(azetidin-1-yl)-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl]phenyl]methanamine
[3-[2-(azetidin-1-yl)-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl]phenyl]methanamine (PubChem CID 165396314) has the molecular formula C17H20N4
and a molecular weight of 280.38 g/mol. Its IUPAC name is [3-[2-(azetidin-1-yl)-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl]phenyl]methanamine.
Molecular Properties
| Compound Name | [3-[2-(azetidin-1-yl)-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl]phenyl]methanamine |
| PubChem CID | 165396314 |
| Molecular Formula | C17H20N4 |
| Molecular Weight | 280.38 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | [3-[2-(azetidin-1-yl)-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl]phenyl]methanamine |
| SMILES | NCc1cccc(-c2nc(N3CCC3)nc3c2CCC3)c1 |
| InChI | InChI=1S/C17H20N4/c18-11-12-4-1-5-13(10-12)16-14-6-2-7-15(14)19-17(20-16)21-8-3-9-21/h1,4-5,10H,2-3,6-9,11,18H2 |
| InChIKey | MEABEYJMMOSMDZ-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.38 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [3-[2-(azetidin-1-yl)-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl]phenyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[2-(azetidin-1-yl)-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl]phenyl]methanamine?
The IUPAC name of [3-[2-(azetidin-1-yl)-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl]phenyl]methanamine (CID 165396314) is [3-[2-(azetidin-1-yl)-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl]phenyl]methanamine.
What is the SMILES notation for [3-[2-(azetidin-1-yl)-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl]phenyl]methanamine?
The canonical SMILES for [3-[2-(azetidin-1-yl)-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl]phenyl]methanamine is NCc1cccc(-c2nc(N3CCC3)nc3c2CCC3)c1.
What is the InChIKey of [3-[2-(azetidin-1-yl)-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl]phenyl]methanamine?
The InChIKey is MEABEYJMMOSMDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20N4/c18-11-12-4-1-5-13(10-12)16-14-6-2-7-15(14)19-17(20-16)21-8-3-9-21/h1,4-5,10H,2-3,6-9,11,18H2.
What are the key properties of [3-[2-(azetidin-1-yl)-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl]phenyl]methanamine?
[3-[2-(azetidin-1-yl)-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl]phenyl]methanamine has a molecular weight of 280.38 g/mol, XLogP of 2.30, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[2-(azetidin-1-yl)-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl]phenyl]methanamine is sourced from PubChem (CID 165396314), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).