C19H23N3 — CID 17035762
4-phenyl-2-piperidin-1-yl-5,6,7,8-tetrahydroquinazoline (PubChem CID 17035762) has the molecular formula C19H23N3 and a molecular weight of 293.41 g/mol. Its IUPAC name is 4-phenyl-2-piperidin-1-yl-5,6,7,8-tetrahydroquinazoline.
| Compound Name | 4-phenyl-2-piperidin-1-yl-5,6,7,8-tetrahydroquinazoline |
|---|---|
| PubChem CID | 17035762 |
| Molecular Formula | C19H23N3 |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.19 |
| IUPAC Name | 4-phenyl-2-piperidin-1-yl-5,6,7,8-tetrahydroquinazoline |
| SMILES | c1ccc(-c2nc(N3CCCCC3)nc3c2CCCC3)cc1 |
| InChI | InChI=1S/C19H23N3/c1-3-9-15(10-4-1)18-16-11-5-6-12-17(16)20-19(21-18)22-13-7-2-8-14-22/h1,3-4,9-10H,2,5-8,11-14H2 |
| InChIKey | ZNVLYVWCBLVKAS-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |