About 2-[ethyl-[3-(hydroxymethylamino)propyl]amino]ethanol;3-methylpentan-2-amine
2-[ethyl-[3-(hydroxymethylamino)propyl]amino]ethanol;3-methylpentan-2-amine (PubChem CID 165397482) has the molecular formula C14H35N3O2
and a molecular weight of 277.45 g/mol. Its IUPAC name is 2-[ethyl-[3-(hydroxymethylamino)propyl]amino]ethanol;3-methylpentan-2-amine.
Molecular Properties
| Compound Name | 2-[ethyl-[3-(hydroxymethylamino)propyl]amino]ethanol;3-methylpentan-2-amine |
| PubChem CID | 165397482 |
| Molecular Formula | C14H35N3O2 |
| Molecular Weight | 277.45 g/mol |
| Exact Mass | 277.27 |
| IUPAC Name | 2-[ethyl-[3-(hydroxymethylamino)propyl]amino]ethanol;3-methylpentan-2-amine |
| SMILES | CCC(C)C(C)N.CCN(CCO)CCCNCO |
| InChI | InChI=1S/C8H20N2O2.C6H15N/c1-2-10(6-7-11)5-3-4-9-8-12;1-4-5(2)6(3)7/h9,11-12H,2-8H2,1H3;5-6H,4,7H2,1-3H3 |
| InChIKey | UETRATGERZGXSV-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.45 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-[ethyl-[3-(hydroxymethylamino)propyl]amino]ethanol;3-methylpentan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[ethyl-[3-(hydroxymethylamino)propyl]amino]ethanol;3-methylpentan-2-amine?
The IUPAC name of 2-[ethyl-[3-(hydroxymethylamino)propyl]amino]ethanol;3-methylpentan-2-amine (CID 165397482) is 2-[ethyl-[3-(hydroxymethylamino)propyl]amino]ethanol;3-methylpentan-2-amine.
What is the SMILES notation for 2-[ethyl-[3-(hydroxymethylamino)propyl]amino]ethanol;3-methylpentan-2-amine?
The canonical SMILES for 2-[ethyl-[3-(hydroxymethylamino)propyl]amino]ethanol;3-methylpentan-2-amine is CCC(C)C(C)N.CCN(CCO)CCCNCO.
What is the InChIKey of 2-[ethyl-[3-(hydroxymethylamino)propyl]amino]ethanol;3-methylpentan-2-amine?
The InChIKey is UETRATGERZGXSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H20N2O2.C6H15N/c1-2-10(6-7-11)5-3-4-9-8-12;1-4-5(2)6(3)7/h9,11-12H,2-8H2,1H3;5-6H,4,7H2,1-3H3.
What are the key properties of 2-[ethyl-[3-(hydroxymethylamino)propyl]amino]ethanol;3-methylpentan-2-amine?
2-[ethyl-[3-(hydroxymethylamino)propyl]amino]ethanol;3-methylpentan-2-amine has a molecular weight of 277.45 g/mol, XLogP of 0.61, 10 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[ethyl-[3-(hydroxymethylamino)propyl]amino]ethanol;3-methylpentan-2-amine is sourced from PubChem (CID 165397482), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).