C32H62BN3O7 — CID 165399167
CID 165399167 (PubChem CID 165399167) has the molecular formula C32H62BN3O7 and a molecular weight of 611.67 g/mol.
| Compound Name | CID 165399167 |
|---|---|
| PubChem CID | 165399167 |
| Molecular Formula | C32H62BN3O7 |
| Molecular Weight | 611.67 g/mol |
| Exact Mass | 611.47 |
| IUPAC Name | — |
| SMILES | CCCCNC(=O)CCC(C)(C)OCC(C)(C)OCCNC(=O)C(C)(C)CC(C)(C)NC(=O)C(C)CC(C)(C)C(=O)O.[BH] |
| InChI | InChI=1S/C32H61N3O7.BH/c1-13-14-17-33-24(36)15-16-31(9,10)42-22-32(11,12)41-19-18-34-26(38)29(5,6)21-30(7,8)35-25(37)23(2)20-28(3,4)27(39)40;/h23H,13-22H2,1-12H3,(H,33,36)(H,34,38)(H,35,37)(H,39,40);1H |
| InChIKey | BLPPHHBDIILGSK-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 143.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.67 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|