C18H19FN4O2 — CID 165399848
7-fluoro-N-(2-oxoethyl)quinoline-4-carboxamide;1-methylpyrrolidine-2-carbonitrile (PubChem CID 165399848) has the molecular formula C18H19FN4O2 and a molecular weight of 342.37 g/mol. Its IUPAC name is 7-fluoro-N-(2-oxoethyl)quinoline-4-carboxamide;1-methylpyrrolidine-2-carbonitrile.
| Compound Name | 7-fluoro-N-(2-oxoethyl)quinoline-4-carboxamide;1-methylpyrrolidine-2-carbonitrile |
|---|---|
| PubChem CID | 165399848 |
| Molecular Formula | C18H19FN4O2 |
| Molecular Weight | 342.37 g/mol |
| Exact Mass | 342.15 |
| IUPAC Name | 7-fluoro-N-(2-oxoethyl)quinoline-4-carboxamide;1-methylpyrrolidine-2-carbonitrile |
| SMILES | CN1CCCC1C#N.O=CCNC(=O)c1ccnc2cc(F)ccc12 |
| InChI | InChI=1S/C12H9FN2O2.C6H10N2/c13-8-1-2-9-10(12(17)15-5-6-16)3-4-14-11(9)7-8;1-8-4-2-3-6(8)5-7/h1-4,6-7H,5H2,(H,15,17);6H,2-4H2,1H3 |
| InChIKey | PGSJCVDFQIBUNV-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 86.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.37 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|