C15H24N3V- — CID 165400261
N,N-dimethyl-2-[1-(2H-pyridin-2-id-5-yl)piperidin-3-yl]propan-2-amine;vanadium (PubChem CID 165400261) has the molecular formula C15H24N3V- and a molecular weight of 297.32 g/mol. Its IUPAC name is N,N-dimethyl-2-[1-(2H-pyridin-2-id-5-yl)piperidin-3-yl]propan-2-amine;vanadium.
| Compound Name | N,N-dimethyl-2-[1-(2H-pyridin-2-id-5-yl)piperidin-3-yl]propan-2-amine;vanadium |
|---|---|
| PubChem CID | 165400261 |
| Molecular Formula | C15H24N3V- |
| Molecular Weight | 297.32 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | N,N-dimethyl-2-[1-(2H-pyridin-2-id-5-yl)piperidin-3-yl]propan-2-amine;vanadium |
| SMILES | CN(C)C(C)(C)C1CCCN(c2cc[c-]nc2)C1.[V] |
| InChI | InChI=1S/C15H24N3.V/c1-15(2,17(3)4)13-7-6-10-18(12-13)14-8-5-9-16-11-14;/h5,8,11,13H,6-7,10,12H2,1-4H3;/q-1; |
| InChIKey | NGNAPFDGKPSCIV-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.32 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|