C11H15FN2 — CID 156752811
5-(3-fluoropiperidin-1-yl)-2-methylpyridine (PubChem CID 156752811) has the molecular formula C11H15FN2 and a molecular weight of 194.25 g/mol. Its IUPAC name is 5-(3-fluoropiperidin-1-yl)-2-methylpyridine.
| Compound Name | 5-(3-fluoropiperidin-1-yl)-2-methylpyridine |
|---|---|
| PubChem CID | 156752811 |
| Molecular Formula | C11H15FN2 |
| Molecular Weight | 194.25 g/mol |
| Exact Mass | 194.12 |
| IUPAC Name | 5-(3-fluoropiperidin-1-yl)-2-methylpyridine |
| SMILES | Cc1ccc(N2CCCC(F)C2)cn1 |
| InChI | InChI=1S/C11H15FN2/c1-9-4-5-11(7-13-9)14-6-2-3-10(12)8-14/h4-5,7,10H,2-3,6,8H2,1H3 |
| InChIKey | URSJWZIKXHNWBC-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.25 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |