C10H14FN3 — CID 163295914
(3R,4R)-4-fluoro-1-(6-methyl-3-pyridinyl)pyrrolidin-3-amine (PubChem CID 163295914) has the molecular formula C10H14FN3 and a molecular weight of 195.24 g/mol. Its IUPAC name is (3R,4R)-4-fluoro-1-(6-methyl-3-pyridinyl)pyrrolidin-3-amine.
| Compound Name | (3R,4R)-4-fluoro-1-(6-methyl-3-pyridinyl)pyrrolidin-3-amine |
|---|---|
| PubChem CID | 163295914 |
| Molecular Formula | C10H14FN3 |
| Molecular Weight | 195.24 g/mol |
| Exact Mass | 195.12 |
| IUPAC Name | (3R,4R)-4-fluoro-1-(6-methyl-3-pyridinyl)pyrrolidin-3-amine |
| SMILES | Cc1ccc(N2C[C@@H](N)[C@H](F)C2)cn1 |
| InChI | InChI=1S/C10H14FN3/c1-7-2-3-8(4-13-7)14-5-9(11)10(12)6-14/h2-4,9-10H,5-6,12H2,1H3/t9-,10-/m1/s1 |
| InChIKey | LPRJJXSSXZCTGZ-NXEZZACHSA-N |
| XLogP | 0.88 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.24 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |