C14H14N2 — CID 118459671
2-(6-methyl-3-pyridinyl)-1,3-dihydroisoindole (PubChem CID 118459671) has the molecular formula C14H14N2 and a molecular weight of 210.28 g/mol. Its IUPAC name is 2-(6-methyl-3-pyridinyl)-1,3-dihydroisoindole.
| Compound Name | 2-(6-methyl-3-pyridinyl)-1,3-dihydroisoindole |
|---|---|
| PubChem CID | 118459671 |
| Molecular Formula | C14H14N2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.12 |
| IUPAC Name | 2-(6-methyl-3-pyridinyl)-1,3-dihydroisoindole |
| SMILES | Cc1ccc(N2Cc3ccccc3C2)cn1 |
| InChI | InChI=1S/C14H14N2/c1-11-6-7-14(8-15-11)16-9-12-4-2-3-5-13(12)10-16/h2-8H,9-10H2,1H3 |
| InChIKey | FGHKLMFSEZEFGQ-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |