C16H28N2O — CID 156651571
2-tert-butyl-4-(6-methyl-3-pyridinyl)morpholine;ethane (PubChem CID 156651571) has the molecular formula C16H28N2O and a molecular weight of 264.41 g/mol. Its IUPAC name is 2-tert-butyl-4-(6-methyl-3-pyridinyl)morpholine;ethane.
| Compound Name | 2-tert-butyl-4-(6-methyl-3-pyridinyl)morpholine;ethane |
|---|---|
| PubChem CID | 156651571 |
| Molecular Formula | C16H28N2O |
| Molecular Weight | 264.41 g/mol |
| Exact Mass | 264.22 |
| IUPAC Name | 2-tert-butyl-4-(6-methyl-3-pyridinyl)morpholine;ethane |
| SMILES | CC.Cc1ccc(N2CCOC(C(C)(C)C)C2)cn1 |
| InChI | InChI=1S/C14H22N2O.C2H6/c1-11-5-6-12(9-15-11)16-7-8-17-13(10-16)14(2,3)4;1-2/h5-6,9,13H,7-8,10H2,1-4H3;1-2H3 |
| InChIKey | GTZJBQUGQATVJE-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.41 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |