C30H42N6 — CID 165401096
1-piperidin-1-yl-N-[8-[[piperidin-1-yl(pyrrolidin-1-yl)methylidene]amino]naphthalen-1-yl]-1-pyrrolidin-1-ylmethanimine (PubChem CID 165401096) has the molecular formula C30H42N6 and a molecular weight of 486.71 g/mol. Its IUPAC name is 1-piperidin-1-yl-N-[8-[[piperidin-1-yl(pyrrolidin-1-yl)methylidene]amino]naphthalen-1-yl]-1-pyrrolidin-1-ylmethanimine.
| Compound Name | 1-piperidin-1-yl-N-[8-[[piperidin-1-yl(pyrrolidin-1-yl)methylidene]amino]naphthalen-1-yl]-1-pyrrolidin-1-ylmethanimine |
|---|---|
| PubChem CID | 165401096 |
| Molecular Formula | C30H42N6 |
| Molecular Weight | 486.71 g/mol |
| Exact Mass | 486.35 |
| IUPAC Name | 1-piperidin-1-yl-N-[8-[[piperidin-1-yl(pyrrolidin-1-yl)methylidene]amino]naphthalen-1-yl]-1-pyrrolidin-1-ylmethanimine |
| SMILES | c1cc(/N=C(\N2CCCCC2)N2CCCC2)c2c(/N=C(\N3CCCCC3)N3CCCC3)cccc2c1 |
| InChI | InChI=1S/C30H42N6/c1-3-17-33(18-4-1)29(35-21-7-8-22-35)31-26-15-11-13-25-14-12-16-27(28(25)26)32-30(36-23-9-10-24-36)34-19-5-2-6-20-34/h11-16H,1-10,17-24H2/b31-29+,32-30+ |
| InChIKey | PGUZSVQHXIRMRG-JWTBXLROSA-N |
| XLogP | 5.98 |
| TPSA | 37.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.71 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|