C11H19N3 — CID 165401782
(3R,6R)-1,6-bis(ethenyl)-N'-methylpiperidine-3-carboximidamide (PubChem CID 165401782) has the molecular formula C11H19N3 and a molecular weight of 193.29 g/mol. Its IUPAC name is (3R,6R)-1,6-bis(ethenyl)-N'-methylpiperidine-3-carboximidamide.
| Compound Name | (3R,6R)-1,6-bis(ethenyl)-N'-methylpiperidine-3-carboximidamide |
|---|---|
| PubChem CID | 165401782 |
| Molecular Formula | C11H19N3 |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.16 |
| IUPAC Name | (3R,6R)-1,6-bis(ethenyl)-N'-methylpiperidine-3-carboximidamide |
| SMILES | C=C[C@H]1CC[C@@H](/C(N)=N/C)CN1C=C |
| InChI | InChI=1S/C11H19N3/c1-4-10-7-6-9(11(12)13-3)8-14(10)5-2/h4-5,9-10H,1-2,6-8H2,3H3,(H2,12,13)/t9-,10+/m1/s1 |
| InChIKey | HHOFXOGDAPKCBY-ZJUUUORDSA-N |
| XLogP | 1.38 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|