C12H21FN4 — CID 167485631
4-[1-(2-fluoroethyl)piperidin-4-yl]-3H-pyridine-2,4-diamine (PubChem CID 167485631) has the molecular formula C12H21FN4 and a molecular weight of 240.33 g/mol. Its IUPAC name is 4-[1-(2-fluoroethyl)piperidin-4-yl]-3H-pyridine-2,4-diamine.
| Compound Name | 4-[1-(2-fluoroethyl)piperidin-4-yl]-3H-pyridine-2,4-diamine |
|---|---|
| PubChem CID | 167485631 |
| Molecular Formula | C12H21FN4 |
| Molecular Weight | 240.33 g/mol |
| Exact Mass | 240.18 |
| IUPAC Name | 4-[1-(2-fluoroethyl)piperidin-4-yl]-3H-pyridine-2,4-diamine |
| SMILES | NC1=NC=CC(N)(C2CCN(CCF)CC2)C1 |
| InChI | InChI=1S/C12H21FN4/c13-4-8-17-6-1-10(2-7-17)12(15)3-5-16-11(14)9-12/h3,5,10H,1-2,4,6-9,15H2,(H2,14,16) |
| InChIKey | AXVQPYRVWQVTTH-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 67.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.33 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |