C9H16FN3 — CID 167485615
4-(4-fluorobutan-2-yl)-3H-pyridine-2,4-diamine (PubChem CID 167485615) has the molecular formula C9H16FN3 and a molecular weight of 185.25 g/mol. Its IUPAC name is 4-(4-fluorobutan-2-yl)-3H-pyridine-2,4-diamine.
| Compound Name | 4-(4-fluorobutan-2-yl)-3H-pyridine-2,4-diamine |
|---|---|
| PubChem CID | 167485615 |
| Molecular Formula | C9H16FN3 |
| Molecular Weight | 185.25 g/mol |
| Exact Mass | 185.13 |
| IUPAC Name | 4-(4-fluorobutan-2-yl)-3H-pyridine-2,4-diamine |
| SMILES | CC(CCF)C1(N)C=CN=C(N)C1 |
| InChI | InChI=1S/C9H16FN3/c1-7(2-4-10)9(12)3-5-13-8(11)6-9/h3,5,7H,2,4,6,12H2,1H3,(H2,11,13) |
| InChIKey | PIZGXIVGHZBTOX-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.25 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |