C25H20F2N4O3S — CID 165401798
methyl (Z)-4-[1-[(2,6-difluorophenyl)methyl]-5-methyl-2,4-dioxo-6-phenylthieno[2,3-d]pyrimidin-3-yl]-4-iminobut-2-enimidate (PubChem CID 165401798) has the molecular formula C25H20F2N4O3S and a molecular weight of 494.52 g/mol. Its IUPAC name is methyl (Z)-4-[1-[(2,6-difluorophenyl)methyl]-5-methyl-2,4-dioxo-6-phenylthieno[2,3-d]pyrimidin-3-yl]-4-iminobut-2-enimidate.
| Compound Name | methyl (Z)-4-[1-[(2,6-difluorophenyl)methyl]-5-methyl-2,4-dioxo-6-phenylthieno[2,3-d]pyrimidin-3-yl]-4-iminobut-2-enimidate |
|---|---|
| PubChem CID | 165401798 |
| Molecular Formula | C25H20F2N4O3S |
| Molecular Weight | 494.52 g/mol |
| Exact Mass | 494.12 |
| IUPAC Name | methyl (Z)-4-[1-[(2,6-difluorophenyl)methyl]-5-methyl-2,4-dioxo-6-phenylthieno[2,3-d]pyrimidin-3-yl]-4-iminobut-2-enimidate |
| SMILES | [H]/N=C(/C=C\C(=N\[H])n1c(=O)c2c(C)c(-c3ccccc3)sc2n(Cc2c(F)cccc2F)c1=O)OC |
| InChI | InChI=1S/C25H20F2N4O3S/c1-14-21-23(32)31(19(28)11-12-20(29)34-2)25(33)30(13-16-17(26)9-6-10-18(16)27)24(21)35-22(14)15-7-4-3-5-8-15/h3-12,28-29H,13H2,1-2H3/b12-11-,28-19-,29-20- |
| InChIKey | GVPSTBOHGJFIQL-JHUXRVLUSA-N |
| XLogP | 4.53 |
| TPSA | 100.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.52 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|