C15H15F4NO5 — CID 165401853
4-(4-amino-3-fluorophenyl)-6-(trifluoromethoxy)benzene-1,2,3,5-tetrol;ethane (PubChem CID 165401853) has the molecular formula C15H15F4NO5 and a molecular weight of 365.28 g/mol. Its IUPAC name is 4-(4-amino-3-fluorophenyl)-6-(trifluoromethoxy)benzene-1,2,3,5-tetrol;ethane.
| Compound Name | 4-(4-amino-3-fluorophenyl)-6-(trifluoromethoxy)benzene-1,2,3,5-tetrol;ethane |
|---|---|
| PubChem CID | 165401853 |
| Molecular Formula | C15H15F4NO5 |
| Molecular Weight | 365.28 g/mol |
| Exact Mass | 365.09 |
| IUPAC Name | 4-(4-amino-3-fluorophenyl)-6-(trifluoromethoxy)benzene-1,2,3,5-tetrol;ethane |
| SMILES | CC.Nc1ccc(-c2c(O)c(O)c(O)c(OC(F)(F)F)c2O)cc1F |
| InChI | InChI=1S/C13H9F4NO5.C2H6/c14-5-3-4(1-2-6(5)18)7-8(19)10(21)11(22)12(9(7)20)23-13(15,16)17;1-2/h1-3,19-22H,18H2;1-2H3 |
| InChIKey | DRSTXNMDRMWQLB-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 116.17 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.28 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|