C16H12F3NO5S — CID 23538286
[4-(4-isocyanophenyl)-2,5-dimethoxyphenyl] trifluoromethanesulfonate (PubChem CID 23538286) has the molecular formula C16H12F3NO5S and a molecular weight of 387.34 g/mol. Its IUPAC name is [4-(4-isocyanophenyl)-2,5-dimethoxyphenyl] trifluoromethanesulfonate.
| Compound Name | [4-(4-isocyanophenyl)-2,5-dimethoxyphenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 23538286 |
| Molecular Formula | C16H12F3NO5S |
| Molecular Weight | 387.34 g/mol |
| Exact Mass | 387.04 |
| IUPAC Name | [4-(4-isocyanophenyl)-2,5-dimethoxyphenyl] trifluoromethanesulfonate |
| SMILES | [C-]#[N+]c1ccc(-c2cc(OC)c(OS(=O)(=O)C(F)(F)F)cc2OC)cc1 |
| InChI | InChI=1S/C16H12F3NO5S/c1-20-11-6-4-10(5-7-11)12-8-14(24-3)15(9-13(12)23-2)25-26(21,22)16(17,18)19/h4-9H,2-3H3 |
| InChIKey | XQEAJDWVBVBAMI-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 66.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.34 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|