C15H14FNO5 — CID 57247733
1-(2-fluoro-4-nitrophenyl)-2,3,4-trimethoxybenzene (PubChem CID 57247733) has the molecular formula C15H14FNO5 and a molecular weight of 307.28 g/mol. Its IUPAC name is 1-(2-fluoro-4-nitrophenyl)-2,3,4-trimethoxybenzene.
| Compound Name | 1-(2-fluoro-4-nitrophenyl)-2,3,4-trimethoxybenzene |
|---|---|
| PubChem CID | 57247733 |
| Molecular Formula | C15H14FNO5 |
| Molecular Weight | 307.28 g/mol |
| Exact Mass | 307.09 |
| IUPAC Name | 1-(2-fluoro-4-nitrophenyl)-2,3,4-trimethoxybenzene |
| SMILES | COc1ccc(-c2ccc([N+](=O)[O-])cc2F)c(OC)c1OC |
| InChI | InChI=1S/C15H14FNO5/c1-20-13-7-6-11(14(21-2)15(13)22-3)10-5-4-9(17(18)19)8-12(10)16/h4-8H,1-3H3 |
| InChIKey | MVMUYGYBSSCCII-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 70.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.28 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|